C11H13N5 — CID 132512945
1-(1-methyltriazol-4-yl)-N-(2-pyridin-2-ylethyl)methanimine (PubChem CID 132512945) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 1-(1-methyltriazol-4-yl)-N-(2-pyridin-2-ylethyl)methanimine.
| Compound Name | 1-(1-methyltriazol-4-yl)-N-(2-pyridin-2-ylethyl)methanimine |
|---|---|
| PubChem CID | 132512945 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-(1-methyltriazol-4-yl)-N-(2-pyridin-2-ylethyl)methanimine |
| SMILES | Cn1cc(/C=N/CCc2ccccn2)nn1 |
| InChI | InChI=1S/C11H13N5/c1-16-9-11(14-15-16)8-12-7-5-10-4-2-3-6-13-10/h2-4,6,8-9H,5,7H2,1H3/b12-8+ |
| InChIKey | MSNDWMIPQPTFEG-XYOKQWHBSA-N |
| XLogP | 0.87 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|