C15H22N4O — CID 167904939
3,3-dimethyl-1-[1-(2-pyridin-2-ylethyl)triazol-4-yl]butan-2-ol (PubChem CID 167904939) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 3,3-dimethyl-1-[1-(2-pyridin-2-ylethyl)triazol-4-yl]butan-2-ol.
| Compound Name | 3,3-dimethyl-1-[1-(2-pyridin-2-ylethyl)triazol-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 167904939 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 3,3-dimethyl-1-[1-(2-pyridin-2-ylethyl)triazol-4-yl]butan-2-ol |
| SMILES | CC(C)(C)C(O)Cc1cn(CCc2ccccn2)nn1 |
| InChI | InChI=1S/C15H22N4O/c1-15(2,3)14(20)10-13-11-19(18-17-13)9-7-12-6-4-5-8-16-12/h4-6,8,11,14,20H,7,9-10H2,1-3H3 |
| InChIKey | GEFZOYMCLHOKQJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |