C13H18N4 — CID 129175051
2-[2-(3-tert-butyl-1,2,4-triazol-4-yl)ethyl]pyridine (PubChem CID 129175051) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-[2-(3-tert-butyl-1,2,4-triazol-4-yl)ethyl]pyridine.
| Compound Name | 2-[2-(3-tert-butyl-1,2,4-triazol-4-yl)ethyl]pyridine |
|---|---|
| PubChem CID | 129175051 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-[2-(3-tert-butyl-1,2,4-triazol-4-yl)ethyl]pyridine |
| SMILES | CC(C)(C)c1nncn1CCc1ccccn1 |
| InChI | InChI=1S/C13H18N4/c1-13(2,3)12-16-15-10-17(12)9-7-11-6-4-5-8-14-11/h4-6,8,10H,7,9H2,1-3H3 |
| InChIKey | VANGHXUOZBWLTJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |