C25H28N4O — CID 139174160
4-propan-2-yl-2,6-bis(2-pyridin-2-ylethyliminomethyl)phenol (PubChem CID 139174160) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 4-propan-2-yl-2,6-bis(2-pyridin-2-ylethyliminomethyl)phenol.
| Compound Name | 4-propan-2-yl-2,6-bis(2-pyridin-2-ylethyliminomethyl)phenol |
|---|---|
| PubChem CID | 139174160 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 4-propan-2-yl-2,6-bis(2-pyridin-2-ylethyliminomethyl)phenol |
| SMILES | CC(C)c1cc(/C=N/CCc2ccccn2)c(O)c(/C=N/CCc2ccccn2)c1 |
| InChI | InChI=1S/C25H28N4O/c1-19(2)20-15-21(17-26-13-9-23-7-3-5-11-28-23)25(30)22(16-20)18-27-14-10-24-8-4-6-12-29-24/h3-8,11-12,15-19,30H,9-10,13-14H2,1-2H3/b26-17+,27-18+ |
| InChIKey | HHCOIPUTXUIBQB-HEPXYTLMSA-N |
| XLogP | 4.63 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|