C33H34N6O — CID 138529941
2,6-bis[bis(pyridin-2-ylmethyl)amino]-4-propan-2-ylphenol (PubChem CID 138529941) has the molecular formula C33H34N6O and a molecular weight of 530.68 g/mol. Its IUPAC name is 2,6-bis[bis(pyridin-2-ylmethyl)amino]-4-propan-2-ylphenol.
| Compound Name | 2,6-bis[bis(pyridin-2-ylmethyl)amino]-4-propan-2-ylphenol |
|---|---|
| PubChem CID | 138529941 |
| Molecular Formula | C33H34N6O |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 2,6-bis[bis(pyridin-2-ylmethyl)amino]-4-propan-2-ylphenol |
| SMILES | CC(C)c1cc(N(Cc2ccccn2)Cc2ccccn2)c(O)c(N(Cc2ccccn2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C33H34N6O/c1-25(2)26-19-31(38(21-27-11-3-7-15-34-27)22-28-12-4-8-16-35-28)33(40)32(20-26)39(23-29-13-5-9-17-36-29)24-30-14-6-10-18-37-30/h3-20,25,40H,21-24H2,1-2H3 |
| InChIKey | OXQZTXKUHPGSLQ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |