C20H18N4O2 — CID 136832873
2,5-bis(pyridin-2-ylmethyliminomethyl)benzene-1,4-diol (PubChem CID 136832873) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2,5-bis(pyridin-2-ylmethyliminomethyl)benzene-1,4-diol.
| Compound Name | 2,5-bis(pyridin-2-ylmethyliminomethyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 136832873 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2,5-bis(pyridin-2-ylmethyliminomethyl)benzene-1,4-diol |
| SMILES | Oc1cc(/C=N/Cc2ccccn2)c(O)cc1/C=N/Cc1ccccn1 |
| InChI | InChI=1S/C20H18N4O2/c25-19-10-16(12-22-14-18-6-2-4-8-24-18)20(26)9-15(19)11-21-13-17-5-1-3-7-23-17/h1-12,25-26H,13-14H2/b21-11+,22-12+ |
| InChIKey | GBYPJTKOGZCHIN-XHQRYOPUSA-N |
| XLogP | 3.13 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|