C21H29N3 — CID 89061491
2,4-ditert-butyl-6-(pyridin-2-ylmethyliminomethyl)aniline (PubChem CID 89061491) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(pyridin-2-ylmethyliminomethyl)aniline.
| Compound Name | 2,4-ditert-butyl-6-(pyridin-2-ylmethyliminomethyl)aniline |
|---|---|
| PubChem CID | 89061491 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | 2,4-ditert-butyl-6-(pyridin-2-ylmethyliminomethyl)aniline |
| SMILES | CC(C)(C)c1cc(/C=N/Cc2ccccn2)c(N)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H29N3/c1-20(2,3)16-11-15(19(22)18(12-16)21(4,5)6)13-23-14-17-9-7-8-10-24-17/h7-13H,14,22H2,1-6H3/b23-13+ |
| InChIKey | GTTPRGFDYYWGDE-YDZHTSKRSA-N |
| XLogP | 4.88 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|