C19H18N2O4V — CID 171438202
benzene-1,2-diol;oxovanadium;2-(pyridin-2-ylmethyliminomethyl)phenol (PubChem CID 171438202) has the molecular formula C19H18N2O4V and a molecular weight of 389.31 g/mol. Its IUPAC name is benzene-1,2-diol;oxovanadium;2-(pyridin-2-ylmethyliminomethyl)phenol.
| Compound Name | benzene-1,2-diol;oxovanadium;2-(pyridin-2-ylmethyliminomethyl)phenol |
|---|---|
| PubChem CID | 171438202 |
| Molecular Formula | C19H18N2O4V |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | benzene-1,2-diol;oxovanadium;2-(pyridin-2-ylmethyliminomethyl)phenol |
| SMILES | O=[V].Oc1ccccc1/C=N/Cc1ccccn1.Oc1ccccc1O |
| InChI | InChI=1S/C13H12N2O.C6H6O2.O.V/c16-13-7-2-1-5-11(13)9-14-10-12-6-3-4-8-15-12;7-5-3-1-2-4-6(5)8;;/h1-9,16H,10H2;1-4,7-8H;;/b14-9+;;; |
| InChIKey | FKBJLRQGRBYBHH-LQFHBUQSSA-N |
| XLogP | 3.38 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|