C12H8I2N4O2 — CID 135715757
N-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]pyrazine-2-carboxamide (PubChem CID 135715757) has the molecular formula C12H8I2N4O2 and a molecular weight of 494.03 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]pyrazine-2-carboxamide.
| Compound Name | N-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 135715757 |
| Molecular Formula | C12H8I2N4O2 |
| Molecular Weight | 494.03 g/mol |
| Exact Mass | 493.87 |
| IUPAC Name | N-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]pyrazine-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc(I)cc(I)c1O)c1cnccn1 |
| InChI | InChI=1S/C12H8I2N4O2/c13-8-3-7(11(19)9(14)4-8)5-17-18-12(20)10-6-15-1-2-16-10/h1-6,19H,(H,18,20)/b17-5+ |
| InChIKey | BXXRRWUEQLQDIE-YAXRCOADSA-N |
| XLogP | 2.16 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.03 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|