C10H7I2N3O2 — CID 3112408
2-cyano-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide (PubChem CID 3112408) has the molecular formula C10H7I2N3O2 and a molecular weight of 454.99 g/mol. Its IUPAC name is 2-cyano-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide.
| Compound Name | 2-cyano-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3112408 |
| Molecular Formula | C10H7I2N3O2 |
| Molecular Weight | 454.99 g/mol |
| Exact Mass | 454.86 |
| IUPAC Name | 2-cyano-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
| SMILES | N#CCC(=O)NN=Cc1cc(I)cc(I)c1O |
| InChI | InChI=1S/C10H7I2N3O2/c11-7-3-6(10(17)8(12)4-7)5-14-15-9(16)1-2-13/h3-5,17H,1H2,(H,15,16) |
| InChIKey | JHSMYJNCGZAGLG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.99 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|