C15H12BrI2N3O2 — CID 136800236
2-(3-bromoanilino)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide (PubChem CID 136800236) has the molecular formula C15H12BrI2N3O2 and a molecular weight of 599.99 g/mol. Its IUPAC name is 2-(3-bromoanilino)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide.
| Compound Name | 2-(3-bromoanilino)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136800236 |
| Molecular Formula | C15H12BrI2N3O2 |
| Molecular Weight | 599.99 g/mol |
| Exact Mass | 598.82 |
| IUPAC Name | 2-(3-bromoanilino)-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
| SMILES | O=C(CNc1cccc(Br)c1)N/N=C\c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C15H12BrI2N3O2/c16-10-2-1-3-12(5-10)19-8-14(22)21-20-7-9-4-11(17)6-13(18)15(9)23/h1-7,19,23H,8H2,(H,21,22)/b20-7- |
| InChIKey | OOOQUCXHNDKLSD-SCDVKCJHSA-N |
| XLogP | 3.93 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.99 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|