C17H18IN3O2 — CID 136824224
N-[(Z)-(2-hydroxy-5-iodo-3-methylphenyl)methylideneamino]-2-(4-methylanilino)acetamide (PubChem CID 136824224) has the molecular formula C17H18IN3O2 and a molecular weight of 423.25 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-5-iodo-3-methylphenyl)methylideneamino]-2-(4-methylanilino)acetamide.
| Compound Name | N-[(Z)-(2-hydroxy-5-iodo-3-methylphenyl)methylideneamino]-2-(4-methylanilino)acetamide |
|---|---|
| PubChem CID | 136824224 |
| Molecular Formula | C17H18IN3O2 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | N-[(Z)-(2-hydroxy-5-iodo-3-methylphenyl)methylideneamino]-2-(4-methylanilino)acetamide |
| SMILES | Cc1ccc(NCC(=O)N/N=C\c2cc(I)cc(C)c2O)cc1 |
| InChI | InChI=1S/C17H18IN3O2/c1-11-3-5-15(6-4-11)19-10-16(22)21-20-9-13-8-14(18)7-12(2)17(13)23/h3-9,19,23H,10H2,1-2H3,(H,21,22)/b20-9- |
| InChIKey | GYOCZPXAOJGHAA-UKWGHVSLSA-N |
| XLogP | 3.18 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|