C16H14Br3N3O2 — CID 2249798
2-(4-methylanilino)-N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 2249798) has the molecular formula C16H14Br3N3O2 and a molecular weight of 520.02 g/mol. Its IUPAC name is 2-(4-methylanilino)-N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-methylanilino)-N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 2249798 |
| Molecular Formula | C16H14Br3N3O2 |
| Molecular Weight | 520.02 g/mol |
| Exact Mass | 516.86 |
| IUPAC Name | 2-(4-methylanilino)-N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(NCC(=O)NN=Cc2c(Br)cc(Br)c(O)c2Br)cc1 |
| InChI | InChI=1S/C16H14Br3N3O2/c1-9-2-4-10(5-3-9)20-8-14(23)22-21-7-11-12(17)6-13(18)16(24)15(11)19/h2-7,20,24H,8H2,1H3,(H,22,23) |
| InChIKey | WLFDVSJZNPXPPX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.02 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|