C17H14Br3ClN2O3 — CID 94842273
2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 94842273) has the molecular formula C17H14Br3ClN2O3 and a molecular weight of 569.48 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 94842273 |
| Molecular Formula | C17H14Br3ClN2O3 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 565.82 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(OCC(=O)N/N=C\c2c(Br)cc(Br)c(O)c2Br)cc(C)c1Cl |
| InChI | InChI=1S/C17H14Br3ClN2O3/c1-8-3-10(4-9(2)16(8)21)26-7-14(24)23-22-6-11-12(18)5-13(19)17(25)15(11)20/h3-6,25H,7H2,1-2H3,(H,23,24)/b22-6- |
| InChIKey | GMHKPBNXRSMELB-HCDFXORVSA-N |
| XLogP | 5.48 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|