C15H8Br3Cl3N2O3 — CID 5209951
N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-2-(2,4,6-trichlorophenoxy)acetamide (PubChem CID 5209951) has the molecular formula C15H8Br3Cl3N2O3 and a molecular weight of 610.31 g/mol. Its IUPAC name is N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-2-(2,4,6-trichlorophenoxy)acetamide.
| Compound Name | N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-2-(2,4,6-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 5209951 |
| Molecular Formula | C15H8Br3Cl3N2O3 |
| Molecular Weight | 610.31 g/mol |
| Exact Mass | 605.72 |
| IUPAC Name | N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-2-(2,4,6-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1c(Cl)cc(Cl)cc1Cl)NN=Cc1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C15H8Br3Cl3N2O3/c16-8-3-9(17)14(25)13(18)7(8)4-22-23-12(24)5-26-15-10(20)1-6(19)2-11(15)21/h1-4,25H,5H2,(H,23,24) |
| InChIKey | MWQVTQUXBJMTSH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.31 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|