C17H15Br3N2O3 — CID 71950391
2-(2,3-dimethylphenoxy)-N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 71950391) has the molecular formula C17H15Br3N2O3 and a molecular weight of 535.03 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 71950391 |
| Molecular Formula | C17H15Br3N2O3 |
| Molecular Weight | 535.03 g/mol |
| Exact Mass | 531.86 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | Cc1cccc(OCC(=O)NN=Cc2c(Br)cc(Br)c(O)c2Br)c1C |
| InChI | InChI=1S/C17H15Br3N2O3/c1-9-4-3-5-14(10(9)2)25-8-15(23)22-21-7-11-12(18)6-13(19)17(24)16(11)20/h3-7,24H,8H2,1-2H3,(H,22,23) |
| InChIKey | SEIYENUCCMZIDA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.03 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|