C22H29NO3 — CID 138115656
4,6-ditert-butyl-3-[(2-methoxyphenyl)iminomethyl]benzene-1,2-diol (PubChem CID 138115656) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 4,6-ditert-butyl-3-[(2-methoxyphenyl)iminomethyl]benzene-1,2-diol.
| Compound Name | 4,6-ditert-butyl-3-[(2-methoxyphenyl)iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 138115656 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 4,6-ditert-butyl-3-[(2-methoxyphenyl)iminomethyl]benzene-1,2-diol |
| SMILES | COc1ccccc1/N=C/c1c(C(C)(C)C)cc(C(C)(C)C)c(O)c1O |
| InChI | InChI=1S/C22H29NO3/c1-21(2,3)15-12-16(22(4,5)6)20(25)19(24)14(15)13-23-17-10-8-9-11-18(17)26-7/h8-13,24-25H,1-7H3/b23-13+ |
| InChIKey | KPGOXMCTDDHLNX-YDZHTSKRSA-N |
| XLogP | 5.45 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|