C25H27NO2 — CID 101216263
1-(2,6-dimethoxyphenyl)-N-[2-(2-methyl-1-phenylpropan-2-yl)phenyl]methanimine (PubChem CID 101216263) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-N-[2-(2-methyl-1-phenylpropan-2-yl)phenyl]methanimine.
| Compound Name | 1-(2,6-dimethoxyphenyl)-N-[2-(2-methyl-1-phenylpropan-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 101216263 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-N-[2-(2-methyl-1-phenylpropan-2-yl)phenyl]methanimine |
| SMILES | COc1cccc(OC)c1/C=N/c1ccccc1C(C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H27NO2/c1-25(2,17-19-11-6-5-7-12-19)21-13-8-9-14-22(21)26-18-20-23(27-3)15-10-16-24(20)28-4/h5-16,18H,17H2,1-4H3/b26-18+ |
| InChIKey | LSFDYIDSQSMDPZ-NLRVBDNBSA-N |
| XLogP | 5.97 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|