C26H25O7P — CID 66688062
2-Benzyl-1,3-bis(2,6-dimethoxyphenyl)-2-phosphorosopropane-1,3-dione (PubChem CID 66688062) has the molecular formula C26H25O7P and a molecular weight of 480.40 g/mol. Its IUPAC name is 2-benzyl-1,3-bis(2,6-dimethoxyphenyl)-2-phosphorosopropane-1,3-dione.
| Compound Name | 2-Benzyl-1,3-bis(2,6-dimethoxyphenyl)-2-phosphorosopropane-1,3-dione |
|---|---|
| PubChem CID | 66688062 |
| Molecular Formula | C26H25O7P |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 2-benzyl-1,3-bis(2,6-dimethoxyphenyl)-2-phosphorosopropane-1,3-dione |
| SMILES | COC1=C(C(=CC=C1)OC)C(=O)C(CC2=CC=CC=C2)(C(=O)C3=C(C=CC=C3OC)OC)P=O |
| InChI | InChI=1S/C26H25O7P/c1-30-18-12-8-13-19(31-2)22(18)24(27)26(34-29,16-17-10-6-5-7-11-17)25(28)23-20(32-3)14-9-15-21(23)33-4/h5-15H,16H2,1-4H3 |
| InChIKey | GKLGQGNIYVZITL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | 627 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|