C25H23O7P — CID 66687456
1,3-bis(2,6-dimethoxyphenyl)-2-phenyl-2-phosphorosopropane-1,3-dione (PubChem CID 66687456) has the molecular formula C25H23O7P and a molecular weight of 466.43 g/mol. Its IUPAC name is 1,3-bis(2,6-dimethoxyphenyl)-2-phenyl-2-phosphorosopropane-1,3-dione.
| Compound Name | 1,3-bis(2,6-dimethoxyphenyl)-2-phenyl-2-phosphorosopropane-1,3-dione |
|---|---|
| PubChem CID | 66687456 |
| Molecular Formula | C25H23O7P |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 1,3-bis(2,6-dimethoxyphenyl)-2-phenyl-2-phosphorosopropane-1,3-dione |
| SMILES | COc1cccc(OC)c1C(=O)C(P=O)(C(=O)c1c(OC)cccc1OC)c1ccccc1 |
| InChI | InChI=1S/C25H23O7P/c1-29-17-12-8-13-18(30-2)21(17)23(26)25(33-28,16-10-6-5-7-11-16)24(27)22-19(31-3)14-9-15-20(22)32-4/h5-15H,1-4H3 |
| InChIKey | IHUQXTWXAFMTBS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|