C26H35NO3 — CID 11441228
1-(2,6-dimethoxyphenyl)-N-[5-methoxy-2-[(E)-2,5,6-trimethylhept-4-en-2-yl]phenyl]methanimine (PubChem CID 11441228) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-N-[5-methoxy-2-[(E)-2,5,6-trimethylhept-4-en-2-yl]phenyl]methanimine.
| Compound Name | 1-(2,6-dimethoxyphenyl)-N-[5-methoxy-2-[(E)-2,5,6-trimethylhept-4-en-2-yl]phenyl]methanimine |
|---|---|
| PubChem CID | 11441228 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-N-[5-methoxy-2-[(E)-2,5,6-trimethylhept-4-en-2-yl]phenyl]methanimine |
| SMILES | COc1ccc(C(C)(C)C/C=C(\C)C(C)C)c(/N=C/c2c(OC)cccc2OC)c1 |
| InChI | InChI=1S/C26H35NO3/c1-18(2)19(3)14-15-26(4,5)22-13-12-20(28-6)16-23(22)27-17-21-24(29-7)10-9-11-25(21)30-8/h9-14,16-18H,15H2,1-8H3/b19-14+,27-17+ |
| InChIKey | MWJPIBOPQISMGZ-PEZGOEQMSA-N |
| XLogP | 6.73 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|