C20H24ClNO3Pd — CID 11385813
chloropalladium(1+);1-(2,6-dimethoxyphenyl)-N-[2-(2-methanidylpropan-2-yl)-5-methoxyphenyl]methanimine (PubChem CID 11385813) has the molecular formula C20H24ClNO3Pd and a molecular weight of 468.29 g/mol. Its IUPAC name is chloropalladium(1+);1-(2,6-dimethoxyphenyl)-N-[2-(2-methanidylpropan-2-yl)-5-methoxyphenyl]methanimine.
| Compound Name | chloropalladium(1+);1-(2,6-dimethoxyphenyl)-N-[2-(2-methanidylpropan-2-yl)-5-methoxyphenyl]methanimine |
|---|---|
| PubChem CID | 11385813 |
| Molecular Formula | C20H24ClNO3Pd |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | chloropalladium(1+);1-(2,6-dimethoxyphenyl)-N-[2-(2-methanidylpropan-2-yl)-5-methoxyphenyl]methanimine |
| SMILES | Cl[Pd+].[CH2-]C(C)(C)c1ccc(OC)cc1/N=C/c1c(OC)cccc1OC |
| InChI | InChI=1S/C20H24NO3.ClH.Pd/c1-20(2,3)16-11-10-14(22-4)12-17(16)21-13-15-18(23-5)8-7-9-19(15)24-6;;/h7-13H,1H2,2-6H3;1H;/q-1;;+2/p-1/b21-13+;; |
| InChIKey | ALJSRQPARSNIGQ-ORKRDPRMSA-M |
| XLogP | 5.26 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|