C20H19NO — CID 126214700
N-(2,3-dimethylphenyl)-1-(2-methoxynaphthalen-1-yl)methanimine (PubChem CID 126214700) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-1-(2-methoxynaphthalen-1-yl)methanimine.
| Compound Name | N-(2,3-dimethylphenyl)-1-(2-methoxynaphthalen-1-yl)methanimine |
|---|---|
| PubChem CID | 126214700 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-(2,3-dimethylphenyl)-1-(2-methoxynaphthalen-1-yl)methanimine |
| SMILES | COc1ccc2ccccc2c1/C=N/c1cccc(C)c1C |
| InChI | InChI=1S/C20H19NO/c1-14-7-6-10-19(15(14)2)21-13-18-17-9-5-4-8-16(17)11-12-20(18)22-3/h4-13H,1-3H3/b21-13+ |
| InChIKey | GHPXLOXRPVUNEP-FYJGNVAPSA-N |
| XLogP | 5.22 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|