C17H23ClN2O — CID 70566550
2-(aminomethyl)-4-tert-butyl-6-(pyridin-3-ylmethyl)phenol;hydrochloride (PubChem CID 70566550) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 2-(aminomethyl)-4-tert-butyl-6-(pyridin-3-ylmethyl)phenol;hydrochloride.
| Compound Name | 2-(aminomethyl)-4-tert-butyl-6-(pyridin-3-ylmethyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 70566550 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-(aminomethyl)-4-tert-butyl-6-(pyridin-3-ylmethyl)phenol;hydrochloride |
| SMILES | CC(C)(C)c1cc(CN)c(O)c(Cc2cccnc2)c1.Cl |
| InChI | InChI=1S/C17H22N2O.ClH/c1-17(2,3)15-8-13(16(20)14(9-15)10-18)7-12-5-4-6-19-11-12;/h4-6,8-9,11,20H,7,10,18H2,1-3H3;1H |
| InChIKey | SQZOPCRSYWTQOA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|