C26H34Cl2N2O — CID 131884560
2,6-bis[(benzylamino)methyl]-4-tert-butylphenol;dihydrochloride (PubChem CID 131884560) has the molecular formula C26H34Cl2N2O and a molecular weight of 461.48 g/mol. Its IUPAC name is 2,6-bis[(benzylamino)methyl]-4-tert-butylphenol;dihydrochloride.
| Compound Name | 2,6-bis[(benzylamino)methyl]-4-tert-butylphenol;dihydrochloride |
|---|---|
| PubChem CID | 131884560 |
| Molecular Formula | C26H34Cl2N2O |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2,6-bis[(benzylamino)methyl]-4-tert-butylphenol;dihydrochloride |
| SMILES | CC(C)(C)c1cc(CNCc2ccccc2)c(O)c(CNCc2ccccc2)c1.Cl.Cl |
| InChI | InChI=1S/C26H32N2O.2ClH/c1-26(2,3)24-14-22(18-27-16-20-10-6-4-7-11-20)25(29)23(15-24)19-28-17-21-12-8-5-9-13-21;;/h4-15,27-29H,16-19H2,1-3H3;2*1H |
| InChIKey | KLOSCXQXPZFLGG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|