C12H20ClNO2 — CID 20553836
4-tert-butyl-2-[(hydroxyamino)methyl]-6-methylphenol;hydrochloride (PubChem CID 20553836) has the molecular formula C12H20ClNO2 and a molecular weight of 245.75 g/mol. Its IUPAC name is 4-tert-butyl-2-[(hydroxyamino)methyl]-6-methylphenol;hydrochloride.
| Compound Name | 4-tert-butyl-2-[(hydroxyamino)methyl]-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 20553836 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-tert-butyl-2-[(hydroxyamino)methyl]-6-methylphenol;hydrochloride |
| SMILES | Cc1cc(C(C)(C)C)cc(CNO)c1O.Cl |
| InChI | InChI=1S/C12H19NO2.ClH/c1-8-5-10(12(2,3)4)6-9(7-13-15)11(8)14;/h5-6,13-15H,7H2,1-4H3;1H |
| InChIKey | WUBMJEBQMZVWLK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|