C28H43NO3 — CID 102157123
4-tert-butyl-2-[[(5-tert-butyl-2-hydroxy-3-methylphenyl)methyl-(4-hydroxybutyl)amino]methyl]-6-methylphenol (PubChem CID 102157123) has the molecular formula C28H43NO3 and a molecular weight of 441.66 g/mol. Its IUPAC name is 4-tert-butyl-2-[[(5-tert-butyl-2-hydroxy-3-methylphenyl)methyl-(4-hydroxybutyl)amino]methyl]-6-methylphenol.
| Compound Name | 4-tert-butyl-2-[[(5-tert-butyl-2-hydroxy-3-methylphenyl)methyl-(4-hydroxybutyl)amino]methyl]-6-methylphenol |
|---|---|
| PubChem CID | 102157123 |
| Molecular Formula | C28H43NO3 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | 4-tert-butyl-2-[[(5-tert-butyl-2-hydroxy-3-methylphenyl)methyl-(4-hydroxybutyl)amino]methyl]-6-methylphenol |
| SMILES | Cc1cc(C(C)(C)C)cc(CN(CCCCO)Cc2cc(C(C)(C)C)cc(C)c2O)c1O |
| InChI | InChI=1S/C28H43NO3/c1-19-13-23(27(3,4)5)15-21(25(19)31)17-29(11-9-10-12-30)18-22-16-24(28(6,7)8)14-20(2)26(22)32/h13-16,30-32H,9-12,17-18H2,1-8H3 |
| InChIKey | WWOWXHDKNKHYTC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|