C9H13NO2 — CID 117276536
6-[(hydroxyamino)methyl]-2,3-dimethylphenol (PubChem CID 117276536) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 6-[(hydroxyamino)methyl]-2,3-dimethylphenol.
| Compound Name | 6-[(hydroxyamino)methyl]-2,3-dimethylphenol |
|---|---|
| PubChem CID | 117276536 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 6-[(hydroxyamino)methyl]-2,3-dimethylphenol |
| SMILES | Cc1ccc(CNO)c(O)c1C |
| InChI | InChI=1S/C9H13NO2/c1-6-3-4-8(5-10-12)9(11)7(6)2/h3-4,10-12H,5H2,1-2H3 |
| InChIKey | BNGBDLRPWPJFCW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|