C15H18N2O — CID 169385241
2,3-dimethyl-6-[(2-phenylhydrazinyl)methyl]phenol (PubChem CID 169385241) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 2,3-dimethyl-6-[(2-phenylhydrazinyl)methyl]phenol.
| Compound Name | 2,3-dimethyl-6-[(2-phenylhydrazinyl)methyl]phenol |
|---|---|
| PubChem CID | 169385241 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 2,3-dimethyl-6-[(2-phenylhydrazinyl)methyl]phenol |
| SMILES | Cc1ccc(CNNc2ccccc2)c(O)c1C |
| InChI | InChI=1S/C15H18N2O/c1-11-8-9-13(15(18)12(11)2)10-16-17-14-6-4-3-5-7-14/h3-9,16-18H,10H2,1-2H3 |
| InChIKey | KGZLDJYTJZOHGL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|