C15H17N3O3 — CID 169385238
3,6-dimethyl-4-nitro-2-[(2-phenylhydrazinyl)methyl]phenol (PubChem CID 169385238) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3,6-dimethyl-4-nitro-2-[(2-phenylhydrazinyl)methyl]phenol.
| Compound Name | 3,6-dimethyl-4-nitro-2-[(2-phenylhydrazinyl)methyl]phenol |
|---|---|
| PubChem CID | 169385238 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3,6-dimethyl-4-nitro-2-[(2-phenylhydrazinyl)methyl]phenol |
| SMILES | Cc1cc([N+](=O)[O-])c(C)c(CNNc2ccccc2)c1O |
| InChI | InChI=1S/C15H17N3O3/c1-10-8-14(18(20)21)11(2)13(15(10)19)9-16-17-12-6-4-3-5-7-12/h3-8,16-17,19H,9H2,1-2H3 |
| InChIKey | ZPVIFJFZVCDVLK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|