C26H24N2O7 — CID 170882825
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-3,6-dimethyl-5-nitrophenyl)propanoic acid (PubChem CID 170882825) has the molecular formula C26H24N2O7 and a molecular weight of 476.49 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-3,6-dimethyl-5-nitrophenyl)propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-3,6-dimethyl-5-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 170882825 |
| Molecular Formula | C26H24N2O7 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-3,6-dimethyl-5-nitrophenyl)propanoic acid |
| SMILES | Cc1cc([N+](=O)[O-])c(C)c(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c1O |
| InChI | InChI=1S/C26H24N2O7/c1-14-11-23(28(33)34)15(2)20(24(14)29)12-22(25(30)31)27-26(32)35-13-21-18-9-5-3-7-16(18)17-8-4-6-10-19(17)21/h3-11,21-22,29H,12-13H2,1-2H3,(H,27,32)(H,30,31) |
| InChIKey | HXRREGROHWFXBG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|