C24H19BrN2O7 — CID 170882241
3-(5-bromo-2-hydroxy-3-nitrophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 170882241) has the molecular formula C24H19BrN2O7 and a molecular weight of 527.33 g/mol. Its IUPAC name is 3-(5-bromo-2-hydroxy-3-nitrophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(5-bromo-2-hydroxy-3-nitrophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 170882241 |
| Molecular Formula | C24H19BrN2O7 |
| Molecular Weight | 527.33 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | 3-(5-bromo-2-hydroxy-3-nitrophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1cc(Br)cc([N+](=O)[O-])c1O)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H19BrN2O7/c25-14-9-13(22(28)21(11-14)27(32)33)10-20(23(29)30)26-24(31)34-12-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-9,11,19-20,28H,10,12H2,(H,26,31)(H,29,30) |
| InChIKey | OKRZUKAEHGTISV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|