C25H22N2O7 — CID 170882378
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-5-methyl-3-nitrophenyl)propanoic acid (PubChem CID 170882378) has the molecular formula C25H22N2O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-5-methyl-3-nitrophenyl)propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-5-methyl-3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 170882378 |
| Molecular Formula | C25H22N2O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-5-methyl-3-nitrophenyl)propanoic acid |
| SMILES | Cc1cc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22N2O7/c1-14-10-15(23(28)22(11-14)27(32)33)12-21(24(29)30)26-25(31)34-13-20-18-8-4-2-6-16(18)17-7-3-5-9-19(17)20/h2-11,20-21,28H,12-13H2,1H3,(H,26,31)(H,29,30) |
| InChIKey | DBWJJIOBDBLUMW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|