C33H30N2O8 — CID 170882600
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-methoxy-3-[(5-methyl-2-nitrophenoxy)methyl]phenyl]propanoic acid (PubChem CID 170882600) has the molecular formula C33H30N2O8 and a molecular weight of 582.61 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-methoxy-3-[(5-methyl-2-nitrophenoxy)methyl]phenyl]propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-methoxy-3-[(5-methyl-2-nitrophenoxy)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 170882600 |
| Molecular Formula | C33H30N2O8 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-methoxy-3-[(5-methyl-2-nitrophenoxy)methyl]phenyl]propanoic acid |
| SMILES | COc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1COc1cc(C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H30N2O8/c1-20-11-13-29(35(39)40)31(15-20)42-18-22-16-21(12-14-30(22)41-2)17-28(32(36)37)34-33(38)43-19-27-25-9-5-3-7-23(25)24-8-4-6-10-26(24)27/h3-16,27-28H,17-19H2,1-2H3,(H,34,38)(H,36,37) |
| InChIKey | GLMZEMZTZGBSMC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|