C32H25F4NO6 — CID 170882512
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]propanoic acid (PubChem CID 170882512) has the molecular formula C32H25F4NO6 and a molecular weight of 595.55 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 170882512 |
| Molecular Formula | C32H25F4NO6 |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 595.16 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-methoxy-3-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]propanoic acid |
| SMILES | COc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C32H25F4NO6/c1-41-27-11-10-17(12-18(27)15-42-30-28(35)24(33)14-25(34)29(30)36)13-26(31(38)39)37-32(40)43-16-23-21-8-4-2-6-19(21)20-7-3-5-9-22(20)23/h2-12,14,23,26H,13,15-16H2,1H3,(H,37,40)(H,38,39) |
| InChIKey | OBBNHFSYBUZPKP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|