C25H23NO6 — CID 103668010
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-3-methoxyphenyl)propanoic acid (PubChem CID 103668010) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-3-methoxyphenyl)propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-3-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 103668010 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxy-3-methoxyphenyl)propanoic acid |
| SMILES | COc1cccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c1O |
| InChI | InChI=1S/C25H23NO6/c1-31-22-12-6-7-15(23(22)27)13-21(24(28)29)26-25(30)32-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h2-12,20-21,27H,13-14H2,1H3,(H,26,30)(H,28,29) |
| InChIKey | SXWVQIGAXHJFCT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |