C24H20FNO5 — CID 155889570
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluoro-2-hydroxyphenyl)propanoic acid (PubChem CID 155889570) has the molecular formula C24H20FNO5 and a molecular weight of 421.42 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluoro-2-hydroxyphenyl)propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluoro-2-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 155889570 |
| Molecular Formula | C24H20FNO5 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluoro-2-hydroxyphenyl)propanoic acid |
| SMILES | O=C(NC(Cc1cccc(F)c1O)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H20FNO5/c25-20-11-5-6-14(22(20)27)12-21(23(28)29)26-24(30)31-13-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-11,19,21,27H,12-13H2,(H,26,30)(H,28,29) |
| InChIKey | CXFVWWJGMJOVFK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |