C24H18Cl2N2O6 — CID 170881834
3-(2,6-dichloro-3-nitrophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 170881834) has the molecular formula C24H18Cl2N2O6 and a molecular weight of 501.32 g/mol. Its IUPAC name is 3-(2,6-dichloro-3-nitrophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(2,6-dichloro-3-nitrophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 170881834 |
| Molecular Formula | C24H18Cl2N2O6 |
| Molecular Weight | 501.32 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 3-(2,6-dichloro-3-nitrophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1c(Cl)ccc([N+](=O)[O-])c1Cl)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H18Cl2N2O6/c25-19-9-10-21(28(32)33)22(26)17(19)11-20(23(29)30)27-24(31)34-12-18-15-7-3-1-5-13(15)14-6-2-4-8-16(14)18/h1-10,18,20H,11-12H2,(H,27,31)(H,29,30) |
| InChIKey | BHLVZQXMUBEUNW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|