C8H7NO6 — CID 139932552
2,6-dihydroxy-3-methyl-5-nitrobenzoic acid (PubChem CID 139932552) has the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. Its IUPAC name is 2,6-dihydroxy-3-methyl-5-nitrobenzoic acid.
| Compound Name | 2,6-dihydroxy-3-methyl-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 139932552 |
| Molecular Formula | C8H7NO6 |
| Molecular Weight | 213.14 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 2,6-dihydroxy-3-methyl-5-nitrobenzoic acid |
| SMILES | Cc1cc([N+](=O)[O-])c(O)c(C(=O)O)c1O |
| InChI | InChI=1S/C8H7NO6/c1-3-2-4(9(14)15)7(11)5(6(3)10)8(12)13/h2,10-11H,1H3,(H,12,13) |
| InChIKey | OBJAZGJLTUYYIZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|