C8H8ClNO3 — CID 10821959
2-chloro-3,4-dimethyl-6-nitrophenol (PubChem CID 10821959) has the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. Its IUPAC name is 2-chloro-3,4-dimethyl-6-nitrophenol.
| Compound Name | 2-chloro-3,4-dimethyl-6-nitrophenol |
|---|---|
| PubChem CID | 10821959 |
| Molecular Formula | C8H8ClNO3 |
| Molecular Weight | 201.61 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 2-chloro-3,4-dimethyl-6-nitrophenol |
| SMILES | Cc1cc([N+](=O)[O-])c(O)c(Cl)c1C |
| InChI | InChI=1S/C8H8ClNO3/c1-4-3-6(10(12)13)8(11)7(9)5(4)2/h3,11H,1-2H3 |
| InChIKey | HZMAMKMOZXKFLG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|