C7H6MnNO7S- — CID 158977171
2,6-dihydroxy-3-methyl-5-nitrobenzenesulfonate;manganese (PubChem CID 158977171) has the molecular formula C7H6MnNO7S- and a molecular weight of 303.13 g/mol. Its IUPAC name is 2,6-dihydroxy-3-methyl-5-nitrobenzenesulfonate;manganese.
| Compound Name | 2,6-dihydroxy-3-methyl-5-nitrobenzenesulfonate;manganese |
|---|---|
| PubChem CID | 158977171 |
| Molecular Formula | C7H6MnNO7S- |
| Molecular Weight | 303.13 g/mol |
| Exact Mass | 302.93 |
| IUPAC Name | 2,6-dihydroxy-3-methyl-5-nitrobenzenesulfonate;manganese |
| SMILES | Cc1cc([N+](=O)[O-])c(O)c(S(=O)(=O)[O-])c1O.[Mn] |
| InChI | InChI=1S/C7H7NO7S.Mn/c1-3-2-4(8(11)12)6(10)7(5(3)9)16(13,14)15;/h2,9-10H,1H3,(H,13,14,15);/p-1 |
| InChIKey | YBSKEUKMQIOIIB-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 140.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.13 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|