C12H4N6NiO18S2 — CID 517494
nickel(2+);bis(2,4,6-trinitrobenzenesulfonate) (PubChem CID 517494) has the molecular formula C12H4N6NiO18S2 and a molecular weight of 643.02 g/mol. Its IUPAC name is nickel(2+);bis(2,4,6-trinitrobenzenesulfonate).
| Compound Name | nickel(2+);bis(2,4,6-trinitrobenzenesulfonate) |
|---|---|
| PubChem CID | 517494 |
| Molecular Formula | C12H4N6NiO18S2 |
| Molecular Weight | 643.02 g/mol |
| Exact Mass | 641.84 |
| IUPAC Name | nickel(2+);bis(2,4,6-trinitrobenzenesulfonate) |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(S(=O)(=O)[O-])c([N+](=O)[O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(S(=O)(=O)[O-])c([N+](=O)[O-])c1.[Ni+2] |
| InChI | InChI=1S/2C6H3N3O9S.Ni/c2*10-7(11)3-1-4(8(12)13)6(19(16,17)18)5(2-3)9(14)15;/h2*1-2H,(H,16,17,18);/q;;+2/p-2 |
| InChIKey | IHVKULDRHMYTGA-UHFFFAOYSA-L |
| XLogP | 0.63 |
| TPSA | 373.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.02 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|