C9H11N3O9S3 — CID 134881829
2-[[dimethyl(methylsulfanyl)-λ4-sulfanyl]oxy-oxoazaniumyl]-4,6-dinitrobenzenesulfonate (PubChem CID 134881829) has the molecular formula C9H11N3O9S3 and a molecular weight of 401.40 g/mol. Its IUPAC name is 2-[[dimethyl(methylsulfanyl)-λ4-sulfanyl]oxy-oxoazaniumyl]-4,6-dinitrobenzenesulfonate.
| Compound Name | 2-[[dimethyl(methylsulfanyl)-λ4-sulfanyl]oxy-oxoazaniumyl]-4,6-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 134881829 |
| Molecular Formula | C9H11N3O9S3 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 2-[[dimethyl(methylsulfanyl)-λ4-sulfanyl]oxy-oxoazaniumyl]-4,6-dinitrobenzenesulfonate |
| SMILES | CSS(C)(C)O[N+](=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H11N3O9S3/c1-22-23(2,3)21-12(17)8-5-6(10(13)14)4-7(11(15)16)9(8)24(18,19)20/h4-5H,1-3H3 |
| InChIKey | RKZUJEYVTICQST-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 172.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|