C9H12N3O7S+ — CID 137286432
(4-hydroxy-3,5-dinitrophenyl)-oxo-(trimethyl-λ4-sulfanyl)oxyazanium (PubChem CID 137286432) has the molecular formula C9H12N3O7S+ and a molecular weight of 306.28 g/mol. Its IUPAC name is (4-hydroxy-3,5-dinitrophenyl)-oxo-(trimethyl-λ4-sulfanyl)oxyazanium.
| Compound Name | (4-hydroxy-3,5-dinitrophenyl)-oxo-(trimethyl-λ4-sulfanyl)oxyazanium |
|---|---|
| PubChem CID | 137286432 |
| Molecular Formula | C9H12N3O7S+ |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (4-hydroxy-3,5-dinitrophenyl)-oxo-(trimethyl-λ4-sulfanyl)oxyazanium |
| SMILES | CS(C)(C)O[N+](=O)c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H11N3O7S/c1-20(2,3)19-12(18)6-4-7(10(14)15)9(13)8(5-6)11(16)17/h4-5H,1-3H3/p+1 |
| InChIKey | CFEXHIOCWFUCKS-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|