C18H9BiN9O21+3 — CID 137234587
bis[[(2-hydroxy-3,5-dinitrophenyl)-oxoazaniumyl]oxy]bismuthanyloxy-(4-hydroxy-3,5-dinitrophenyl)-oxoazanium (PubChem CID 137234587) has the molecular formula C18H9BiN9O21+3 and a molecular weight of 896.29 g/mol. Its IUPAC name is bis[[(2-hydroxy-3,5-dinitrophenyl)-oxoazaniumyl]oxy]bismuthanyloxy-(4-hydroxy-3,5-dinitrophenyl)-oxoazanium.
| Compound Name | bis[[(2-hydroxy-3,5-dinitrophenyl)-oxoazaniumyl]oxy]bismuthanyloxy-(4-hydroxy-3,5-dinitrophenyl)-oxoazanium |
|---|---|
| PubChem CID | 137234587 |
| Molecular Formula | C18H9BiN9O21+3 |
| Molecular Weight | 896.29 g/mol |
| Exact Mass | 895.97 |
| IUPAC Name | bis[[(2-hydroxy-3,5-dinitrophenyl)-oxoazaniumyl]oxy]bismuthanyloxy-(4-hydroxy-3,5-dinitrophenyl)-oxoazanium |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)O[Bi](O[N+](=O)c2cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c2)O[N+](=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)c1 |
| InChI | InChI=1S/3C6H3N3O7.Bi/c3*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h3*1-2,10H;/q;;;+3 |
| InChIKey | UIUYHHVNMIGVPA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 407.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|