C15H24N3O9S3+ — CID 54612016
1-dimethylsulfoniopentan-2-yl(dimethyl)sulfanium;2,4,6-trinitrobenzenesulfonate (PubChem CID 54612016) has the molecular formula C15H24N3O9S3+ and a molecular weight of 486.57 g/mol. Its IUPAC name is 1-dimethylsulfoniopentan-2-yl(dimethyl)sulfanium;2,4,6-trinitrobenzenesulfonate.
| Compound Name | 1-dimethylsulfoniopentan-2-yl(dimethyl)sulfanium;2,4,6-trinitrobenzenesulfonate |
|---|---|
| PubChem CID | 54612016 |
| Molecular Formula | C15H24N3O9S3+ |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 1-dimethylsulfoniopentan-2-yl(dimethyl)sulfanium;2,4,6-trinitrobenzenesulfonate |
| SMILES | CCCC(C[S+](C)C)[S+](C)C.O=[N+]([O-])c1cc([N+](=O)[O-])c(S(=O)(=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H22S2.C6H3N3O9S/c1-6-7-9(11(4)5)8-10(2)3;10-7(11)3-1-4(8(12)13)6(19(16,17)18)5(2-3)9(14)15/h9H,6-8H2,1-5H3;1-2H,(H,16,17,18)/q+2;/p-1 |
| InChIKey | DZPOSRUTWPQGJN-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 186.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|