C12H17N3O10S — CID 159047558
triethyloxidanium;2,4,6-trinitrobenzenesulfonate (PubChem CID 159047558) has the molecular formula C12H17N3O10S and a molecular weight of 395.35 g/mol. Its IUPAC name is triethyloxidanium;2,4,6-trinitrobenzenesulfonate.
| Compound Name | triethyloxidanium;2,4,6-trinitrobenzenesulfonate |
|---|---|
| PubChem CID | 159047558 |
| Molecular Formula | C12H17N3O10S |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | triethyloxidanium;2,4,6-trinitrobenzenesulfonate |
| SMILES | CC[O+](CC)CC.O=[N+]([O-])c1cc([N+](=O)[O-])c(S(=O)(=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O9S.C6H15O/c10-7(11)3-1-4(8(12)13)6(19(16,17)18)5(2-3)9(14)15;1-4-7(5-2)6-3/h1-2H,(H,16,17,18);4-6H2,1-3H3/q;+1/p-1 |
| InChIKey | JWVPDNRLZNICOG-UHFFFAOYSA-M |
| XLogP | 1.91 |
| TPSA | 189.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|