C7H6N2NaO7S+ — CID 54602379
sodium 2-methyl-3,5-dinitrobenzenesulfonic acid (PubChem CID 54602379) has the molecular formula C7H6N2NaO7S+ and a molecular weight of 285.19 g/mol. Its IUPAC name is sodium 2-methyl-3,5-dinitrobenzenesulfonic acid.
| Compound Name | sodium 2-methyl-3,5-dinitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 54602379 |
| Molecular Formula | C7H6N2NaO7S+ |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | sodium 2-methyl-3,5-dinitrobenzenesulfonic acid |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C7H6N2O7S.Na/c1-4-6(9(12)13)2-5(8(10)11)3-7(4)17(14,15)16;/h2-3H,1H3,(H,14,15,16);/q;+1 |
| InChIKey | XDILPOZREVZSHM-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|