C7H7N3O6S — CID 4554776
2-methyl-3,5-dinitrobenzenesulfonamide (PubChem CID 4554776) has the molecular formula C7H7N3O6S and a molecular weight of 261.21 g/mol. Its IUPAC name is 2-methyl-3,5-dinitrobenzenesulfonamide.
| Compound Name | 2-methyl-3,5-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4554776 |
| Molecular Formula | C7H7N3O6S |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 2-methyl-3,5-dinitrobenzenesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C7H7N3O6S/c1-4-6(10(13)14)2-5(9(11)12)3-7(4)17(8,15)16/h2-3H,1H3,(H2,8,15,16) |
| InChIKey | HLJIJDAXQWLCSD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|