C7H7N3O6S — CID 87787870
3-methyl-2,4-dinitrobenzenesulfonamide (PubChem CID 87787870) has the molecular formula C7H7N3O6S and a molecular weight of 261.21 g/mol. Its IUPAC name is 3-methyl-2,4-dinitrobenzenesulfonamide.
| Compound Name | 3-methyl-2,4-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 87787870 |
| Molecular Formula | C7H7N3O6S |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 3-methyl-2,4-dinitrobenzenesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])ccc(S(N)(=O)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N3O6S/c1-4-5(9(11)12)2-3-6(17(8,15)16)7(4)10(13)14/h2-3H,1H3,(H2,8,15,16) |
| InChIKey | HDEUEKKPKMRGSO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|